![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| desktop.ini | 2020-08-24 18:22 | 136 | |
| Women In Govt/ | 2024-09-05 09:45 | - | |
| Volunteers of Louisi..> | 2024-10-15 09:48 | - | |
| Volunteer of America/ | 2024-08-09 08:07 | - | |
| US Drug/ | 2024-03-25 10:16 | - | |
| Tiger Rag Radio Show/ | 2022-11-02 15:31 | - | |
| Tiger Rag/ | 2024-08-09 08:06 | - | |
| TCM/ | 2024-04-22 11:22 | - | |
| Sunshine/ | 2024-08-09 08:05 | - | |
| Stihl/ | 2024-11-29 07:49 | - | |
| Soybean Bd/ | 2024-11-12 13:44 | - | |
| Southern University/ | 2024-02-29 08:42 | - | |
| Sec of State/ | 2024-12-17 08:35 | - | |
| Ralphs Market/ | 2024-08-09 08:03 | - | |
| QTIS/ | 2022-11-02 15:30 | - | |
| Public Health/ | 2024-08-09 08:03 | - | |
| PERC/ | 2024-09-10 10:08 | - | |
| Operation Lifesaver/ | 2024-09-24 08:48 | - | |
| New Orleans and Comp..> | 2024-10-02 08:39 | - | |
| National Safety Coun..> | 2024-10-16 08:52 | - | |
| Moon Griffon/ | 2022-11-02 15:29 | - | |
| Max Home/ | 2024-03-05 10:58 | - | |
| Luba/ | 2023-08-10 09:47 | - | |
| Letlow/ | 2024-03-14 08:55 | - | |
| Legal Services/ | 2024-03-26 09:28 | - | |
| LA Tourism/ | 2024-10-17 08:18 | - | |
| LA Strawberry Board/ | 2024-08-09 08:00 | - | |
| LA Soybean/ | 2024-11-06 08:49 | - | |
| LA Soy Association/ | 2024-08-09 07:59 | - | |
| LA Rice Bd/ | 2024-10-31 11:22 | - | |
| LA Propane/ | 2024-03-06 10:22 | - | |
| LA Lottery/ | 2024-12-20 08:07 | - | |
| LA Land Bank/ | 2024-10-31 07:50 | - | |
| LA Judicial/ | 2024-11-26 13:59 | - | |
| LA Hwy Safety/ | 2024-08-27 08:43 | - | |
| LA Egg/ | 2024-12-12 12:47 | - | |
| LA Dept of Ag/ | 2023-06-08 08:44 | - | |
| LA Crawfish/ | 2024-09-11 10:18 | - | |
| LA Beef/ | 2024-08-15 08:15 | - | |
| LA Beautiful/ | 2024-08-09 07:54 | - | |
| LA Ag Hall of Distin..> | 2022-11-02 15:27 | - | |
| Kids Online/ | 2024-05-01 09:34 | - | |
| Keep LA Beautiful/ | 2024-08-09 07:54 | - | |
| Invest In LA/ | 2024-08-22 08:46 | - | |
| Infoworx/ | 2024-02-05 13:45 | - | |
| Hwy Safety/ | 2024-05-22 08:59 | - | |
| Helm Paint/ | 2024-04-04 08:56 | - | |
| Hall of Distinction/ | 2024-10-25 11:39 | - | |
| HOD/ | 2024-10-25 14:37 | - | |
| HHS/ | 2024-12-11 13:46 | - | |
| G Networks/ | 2024-12-19 10:07 | - | |
| First South Farm Cre..> | 2024-10-10 08:01 | - | |
| Farm Bureau/ | 2024-08-08 14:10 | - | |
| Entergy Svc/ | 2024-08-08 14:10 | - | |
| Entergy Solutions/ | 2024-08-08 14:10 | - | |
| Entergy/ | 2024-11-10 09:25 | - | |
| Dept of Justice/ | 2024-08-08 14:09 | - | |
| Dept of Insurance/ | 2024-08-08 14:09 | - | |
| Dept of Health/ | 2024-08-30 13:19 | - | |
| Cummins/ | 2022-11-02 15:25 | - | |
| Corteva/ | 2024-09-11 09:01 | - | |
| Cong Letlow/ | 2023-12-13 14:35 | - | |
| Cleo Fields/ | 2024-07-23 13:54 | - | |
| Center For Medicare/ | 2024-12-10 10:03 | - | |
| CTR Medicare/ | 2024-12-15 18:19 | - | |
| CTR Medicaid/ | 2024-10-30 13:54 | - | |
| CMS-LIS/ | 2024-06-27 11:40 | - | |
| Blue Cross/ | 2024-10-17 08:23 | - | |
| Blue Bell/ | 2024-08-08 14:06 | - | |
| Bayer Cotton Traits/ | 2024-10-08 09:58 | - | |
| Bayer Asgrow/ | 2024-09-18 10:28 | - | |
| BASF Stoneville/ | 2024-10-23 13:46 | - | |
| BASF Rice/ | 2024-08-08 14:05 | - | |
| BASF Revylok/ | 2024-12-12 08:58 | - | |
| Atmos Energy/ | 2024-03-27 09:48 | - | |
| Applied Digital/ | 2024-04-02 10:39 | - | |
| Am Sugar Cane/ | 2024-08-13 10:27 | - | |
| AARP/ | 2024-11-22 10:22 | - | |