![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| AARP/ | 2026-08-13 12:55 | - | |
| AM Leadership/ | 2026-08-13 12:55 | - | |
| Accountability Project/ | 2026-08-13 12:55 | - | |
| Action New Intiative/ | 2026-08-13 12:55 | - | |
| Am Sugar Cane/ | 2026-08-13 12:55 | - | |
| Applied Digital/ | 2026-08-13 12:55 | - | |
| Atmos Energy/ | 2026-08-13 12:55 | - | |
| BASF Engenia/ | 2026-08-13 12:55 | - | |
| BASF Liberty/ | 2026-08-13 12:55 | - | |
| BASF Revylok/ | 2026-08-13 12:55 | - | |
| BASF Rice/ | 2026-08-13 12:55 | - | |
| BASF Stoneville/ | 2026-08-13 12:55 | - | |
| BR Gamblers/ | 2026-08-13 12:55 | - | |
| Bayer Asgrow/ | 2026-08-13 12:55 | - | |
| Bayer Cotton Traits/ | 2026-08-13 12:55 | - | |
| Blue Bell/ | 2026-08-13 12:55 | - | |
| Blue Cross/ | 2026-08-13 12:55 | - | |
| Blue Emu/ | 2026-08-13 12:55 | - | |
| Boudreaux Electric/ | 2026-08-13 12:55 | - | |
| CMS LIS/ | 2026-08-13 12:55 | - | |
| CTR Medicaid/ | 2026-08-13 12:56 | - | |
| CTR Medicare/ | 2026-08-13 12:56 | - | |
| Cajun Visa/ | 2026-08-13 12:55 | - | |
| Center For Medicare/ | 2026-08-13 12:55 | - | |
| Cleo Fields/ | 2026-08-13 12:55 | - | |
| Cong Letlow/ | 2026-08-13 12:55 | - | |
| Corteva/ | 2026-08-13 12:56 | - | |
| Crawler Supply/ | 2026-08-13 12:56 | - | |
| Cummins/ | 2026-08-13 12:56 | - | |
| Delta Utilities/ | 2026-08-13 12:56 | - | |
| Dept of Health/ | 2026-08-13 12:56 | - | |
| Dept of Health Gambl..> | 2026-08-13 12:56 | - | |
| Dept of Insurance/ | 2026-08-13 12:56 | - | |
| Dept of Justice/ | 2026-08-13 12:56 | - | |
| Entergy/ | 2026-08-13 12:56 | - | |
| Entergy Solutions/ | 2026-08-13 12:56 | - | |
| Entergy Svc/ | 2026-08-13 12:56 | - | |
| Farm Bureau/ | 2026-08-13 12:56 | - | |
| First South Farm Cre..> | 2026-08-13 12:56 | - | |
| Fleming/ | 2026-08-13 12:56 | - | |
| G Networks/ | 2026-08-13 12:56 | - | |
| HHS/ | 2026-08-13 12:56 | - | |
| HOD/ | 2026-08-13 12:56 | - | |
| Hall of Distinction/ | 2026-08-13 12:56 | - | |
| Helm Paint/ | 2026-08-13 12:56 | - | |
| Hunter Lundy/ | 2026-08-13 12:56 | - | |
| Hwy Safety/ | 2026-08-13 12:56 | - | |
| Infoworx/ | 2026-08-13 12:56 | - | |
| Invest In LA/ | 2026-08-13 12:56 | - | |
| Keep LA Beautiful/ | 2026-08-13 12:56 | - | |
| Kids Online/ | 2026-08-13 12:56 | - | |
| Kubota/ | 2026-08-13 12:56 | - | |
| LA Ag Hall of Distin..> | 2026-08-13 12:56 | - | |
| LA Beautiful/ | 2026-08-13 12:56 | - | |
| LA Beef/ | 2026-08-13 12:56 | - | |
| LA Crawfish/ | 2026-08-13 12:56 | - | |
| LA Dept of Ag/ | 2026-08-13 12:56 | - | |
| LA Egg/ | 2026-08-13 12:56 | - | |
| LA Freedom/ | 2026-08-13 12:56 | - | |
| LA Hwy Safety/ | 2026-08-13 12:56 | - | |
| LA Judicial/ | 2026-08-13 12:56 | - | |
| LA Land Bank/ | 2026-08-13 12:56 | - | |
| LA Lottery/ | 2026-08-15 13:53 | - | |
| LA Propane/ | 2026-08-13 12:56 | - | |
| LA Rice Bd/ | 2026-08-13 12:56 | - | |
| LA Shrimp/ | 2026-08-13 12:56 | - | |
| LA Soy Association/ | 2026-08-13 12:56 | - | |
| LA Soybean/ | 2026-08-13 12:56 | - | |
| LA Strawberry Board/ | 2026-08-13 12:57 | - | |
| LA Tourism/ | 2026-08-13 12:57 | - | |
| Legal Services/ | 2026-08-13 12:57 | - | |
| Letlow/ | 2026-08-13 12:57 | - | |
| Luba/ | 2026-08-13 12:57 | - | |
| Make America Great/ | 2026-08-13 12:57 | - | |
| Max Home/ | 2026-08-13 12:57 | - | |
| Moon Griffon/ | 2026-08-13 12:57 | - | |
| National Safety Coun..> | 2026-08-13 12:57 | - | |
| New Orleans and Comp..> | 2026-08-13 12:57 | - | |
| New folder/ | 2025-01-31 10:24 | - | |
| Operation Lifesaver/ | 2026-08-13 12:57 | - | |
| PERC/ | 2026-08-13 12:57 | - | |
| Project LA/ | 2026-08-13 12:57 | - | |
| Public Health/ | 2026-08-13 12:57 | - | |
| QTIS/ | 2026-08-13 12:57 | - | |
| Ralphs Market/ | 2026-08-13 12:57 | - | |
| Sec of State/ | 2026-08-13 12:57 | - | |
| Simplot/ | 2026-08-13 12:57 | - | |
| Southern University/ | 2026-08-13 12:57 | - | |
| Soybean Bd/ | 2026-08-13 12:57 | - | |
| Stihl/ | 2026-08-13 13:06 | - | |
| Sunshine/ | 2026-08-13 12:57 | - | |
| Super Chevy Dealers/ | 2026-08-13 12:57 | - | |
| Syngenta Miravis/ | 2026-08-13 12:57 | - | |
| TCM/ | 2026-08-13 12:57 | - | |
| Tiger Rag/ | 2026-08-13 12:57 | - | |
| Tiger Rag Radio Show/ | 2026-08-13 12:57 | - | |
| UHC/ | 2026-08-13 12:57 | - | |
| US Drug/ | 2026-08-13 12:57 | - | |
| Univ View/ | 2026-08-13 12:57 | - | |
| Volunteer of America/ | 2026-08-13 12:57 | - | |
| Volunteers of Louisi..> | 2026-08-13 12:57 | - | |
| Women In Govt/ | 2026-08-13 12:57 | - | |
| desktop.ini | 2020-08-24 18:22 | 136 | |