![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| desktop.ini | 2020-08-24 18:22 | 136 | |
| Cummins/ | 2022-11-02 15:25 | - | |
| LA Ag Hall of Distin..> | 2022-11-02 15:27 | - | |
| Moon Griffon/ | 2022-11-02 15:29 | - | |
| QTIS/ | 2022-11-02 15:30 | - | |
| Tiger Rag Radio Show/ | 2022-11-02 15:31 | - | |
| LA Dept of Ag/ | 2023-06-08 08:44 | - | |
| Luba/ | 2023-08-10 09:47 | - | |
| Cong Letlow/ | 2023-12-13 14:35 | - | |
| Infoworx/ | 2024-02-05 13:45 | - | |
| Southern University/ | 2024-02-29 08:42 | - | |
| Max Home/ | 2024-03-05 10:58 | - | |
| LA Propane/ | 2024-03-06 10:22 | - | |
| Legal Services/ | 2024-03-26 09:28 | - | |
| Applied Digital/ | 2024-04-02 10:39 | - | |
| Helm Paint/ | 2024-04-04 08:56 | - | |
| TCM/ | 2024-04-22 11:22 | - | |
| Kids Online/ | 2024-05-01 09:34 | - | |
| Hwy Safety/ | 2024-05-22 08:59 | - | |
| CMS-LIS/ | 2024-06-27 11:40 | - | |
| Cleo Fields/ | 2024-07-23 13:54 | - | |
| BASF Rice/ | 2024-08-08 14:05 | - | |
| Dept of Insurance/ | 2024-08-08 14:09 | - | |
| Dept of Justice/ | 2024-08-08 14:09 | - | |
| Entergy Solutions/ | 2024-08-08 14:10 | - | |
| Entergy Svc/ | 2024-08-08 14:10 | - | |
| Farm Bureau/ | 2024-08-08 14:10 | - | |
| Keep LA Beautiful/ | 2024-08-09 07:54 | - | |
| LA Beautiful/ | 2024-08-09 07:54 | - | |
| LA Soy Association/ | 2024-08-09 07:59 | - | |
| Public Health/ | 2024-08-09 08:03 | - | |
| Ralphs Market/ | 2024-08-09 08:03 | - | |
| Tiger Rag/ | 2024-08-09 08:06 | - | |
| Volunteer of America/ | 2024-08-09 08:07 | - | |
| Am Sugar Cane/ | 2024-08-13 10:27 | - | |
| Invest In LA/ | 2024-08-22 08:46 | - | |
| LA Hwy Safety/ | 2024-08-27 08:43 | - | |
| PERC/ | 2024-09-10 10:08 | - | |
| Bayer Asgrow/ | 2024-09-18 10:28 | - | |
| Operation Lifesaver/ | 2024-09-24 08:48 | - | |
| New Orleans and Comp..> | 2024-10-02 08:39 | - | |
| Bayer Cotton Traits/ | 2024-10-08 09:58 | - | |
| First South Farm Cre..> | 2024-10-10 08:01 | - | |
| Volunteers of Louisi..> | 2024-10-15 09:48 | - | |
| National Safety Coun..> | 2024-10-16 08:52 | - | |
| Blue Cross/ | 2024-10-17 08:23 | - | |
| Hall of Distinction/ | 2024-10-25 11:39 | - | |
| HOD/ | 2024-10-25 14:37 | - | |
| CTR Medicaid/ | 2024-10-30 13:54 | - | |
| LA Land Bank/ | 2024-10-31 07:50 | - | |
| LA Rice Bd/ | 2024-10-31 11:22 | - | |
| Entergy/ | 2024-11-10 09:25 | - | |
| Soybean Bd/ | 2024-11-12 13:44 | - | |
| LA Judicial/ | 2024-11-26 13:59 | - | |
| HHS/ | 2024-12-11 13:46 | - | |
| CTR Medicare/ | 2024-12-15 18:19 | - | |
| Boudreaux Electric/ | 2024-12-31 14:20 | - | |
| Blue Emu/ | 2025-01-08 13:50 | - | |
| Center For Medicare/ | 2025-01-08 16:22 | - | |
| AM Leadership/ | 2025-01-10 09:43 | - | |
| BASF Revylok/ | 2025-01-16 09:05 | - | |
| BASF Stoneville/ | 2025-01-23 08:40 | - | |
| Sunshine/ | 2025-01-26 16:23 | - | |
| New folder/ | 2025-01-31 10:24 | - | |
| LA Strawberry Board/ | 2025-02-11 09:49 | - | |
| Kubota/ | 2025-02-28 08:30 | - | |
| Women In Govt/ | 2025-03-05 10:27 | - | |
| Crawler Supply/ | 2025-03-05 11:36 | - | |
| BASF Liberty/ | 2025-03-06 09:05 | - | |
| Dept of Health/ | 2025-03-12 09:48 | - | |
| Hunter Lundy/ | 2025-03-13 14:11 | - | |
| Univ View/ | 2025-03-18 09:04 | - | |
| Dept of Health Gambl..> | 2025-03-20 08:46 | - | |
| Make America Great/ | 2025-03-22 12:09 | - | |
| LA Egg/ | 2025-03-27 08:02 | - | |
| US Drug/ | 2025-03-27 08:05 | - | |
| Atmos Energy/ | 2025-03-27 10:07 | - | |
| Blue Bell/ | 2025-04-04 09:07 | - | |
| Stihl/ | 2025-04-09 11:13 | - | |
| Corteva/ | 2025-04-11 14:25 | - | |
| Project LA/ | 2025-04-17 08:09 | - | |
| LA Soybean/ | 2025-04-17 11:15 | - | |
| LA Crawfish/ | 2025-04-22 08:58 | - | |
| Sec of State/ | 2025-04-25 08:15 | - | |
| AARP/ | 2025-04-25 11:11 | - | |
| Super Chevy Dealers/ | 2025-04-29 13:50 | - | |
| Letlow/ | 2025-05-02 12:15 | - | |
| LA Lottery/ | 2025-05-06 11:16 | - | |
| Syngenta Miravis/ | 2025-05-07 14:28 | - | |
| LA Tourism/ | 2025-05-08 07:58 | - | |
| LA Beef/ | 2025-05-08 08:20 | - | |
| G Networks/ | 2025-05-08 09:18 | - | |