![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 402 Venture/ | 2022-11-02 15:24 | - | |
| AARP/ | 2023-11-14 08:29 | - | |
| AT&T/ | 2022-11-02 15:25 | - | |
| Ad Council/ | 2023-11-09 10:17 | - | |
| Adama/ | 2022-11-02 15:24 | - | |
| AgBitech/ | 2022-11-02 15:24 | - | |
| Am Sugar Cane/ | 2023-09-12 11:00 | - | |
| AmeriHealth/ | 2022-11-15 08:39 | - | |
| American Hospital/ | 2022-11-02 15:24 | - | |
| Atmos Energy/ | 2022-11-02 15:25 | - | |
| BASF/ | 2022-11-02 15:25 | - | |
| BASF Revylok/ | 2023-08-31 09:00 | - | |
| BASF Reward/ | 2022-11-02 15:25 | - | |
| BASF Rice/ | 2022-12-13 11:01 | - | |
| Bayer Crop Science/ | 2023-02-02 08:31 | - | |
| Berni Consult/ | 2022-11-02 15:25 | - | |
| Beus Beko/ | 2022-11-02 15:25 | - | |
| Billy Graham/ | 2022-12-20 08:21 | - | |
| Blood Donation/ | 2023-02-28 08:54 | - | |
| Blue Bell/ | 2023-07-12 08:35 | - | |
| Blue Cross/ | 2023-10-02 09:14 | - | |
| Bone Health/ | 2022-11-02 15:25 | - | |
| Brandt/ | 2023-03-23 10:09 | - | |
| Bryson Law Firm/ | 2022-11-02 15:25 | - | |
| CDC/ | 2023-11-16 10:32 | - | |
| CTR Medicaid/ | 2023-06-29 08:30 | - | |
| Center For Medicare/ | 2023-07-31 11:18 | - | |
| Citizens Energy/ | 2022-11-02 15:25 | - | |
| Citizens Res Energy ..> | 2022-11-02 15:25 | - | |
| Clay Schexnayder/ | 2023-10-03 14:20 | - | |
| Coach To Cure/ | 2022-11-02 15:25 | - | |
| Corteva/ | 2023-09-14 08:30 | - | |
| Cox Sports/ | 2022-11-02 15:25 | - | |
| Crawler/ | 2022-11-02 15:25 | - | |
| Cummins/ | 2022-11-02 15:25 | - | |
| Deltapine/ | 2023-11-07 11:35 | - | |
| Dept of Health/ | 2023-11-08 09:58 | - | |
| Dept of Insurance/ | 2023-05-23 09:21 | - | |
| Dept of Justice/ | 2023-06-13 08:49 | - | |
| DraftKings/ | 2022-11-02 15:26 | - | |
| Elderly Affairs/ | 2022-11-02 15:26 | - | |
| Energy Svc/ | 2023-11-03 11:55 | - | |
| Entergy/ | 2022-11-02 15:26 | - | |
| Entergy Solutions/ | 2023-10-06 11:32 | - | |
| Entergy Svc/ | 2023-11-03 11:57 | - | |
| FMC/ | 2022-11-02 15:26 | - | |
| Fair Housing/ | 2022-11-02 15:26 | - | |
| Farm Bureau/ | 2022-11-02 15:26 | - | |
| Federation of Teachers/ | 2022-11-02 15:26 | - | |
| First South/ | 2023-10-26 09:02 | - | |
| Fleming/ | 2023-11-02 08:25 | - | |
| Fors Marsh Group/ | 2022-11-02 15:26 | - | |
| G Networks/ | 2023-11-21 08:28 | - | |
| GOHSEP/ | 2022-11-02 15:27 | - | |
| Guillory Lt Gov/ | 2023-03-22 13:17 | - | |
| HOD/ | 2022-11-02 15:27 | - | |
| Hall of Distinction/ | 2022-11-02 15:27 | - | |
| Health and Human Ser..> | 2022-12-13 10:57 | - | |
| Healthcare Gov/ | 2022-11-02 15:27 | - | |
| Helena/ | 2023-03-02 09:45 | - | |
| HiBid 2020/ | 2022-11-02 15:27 | - | |
| Honda/ | 2022-11-02 15:27 | - | |
| Hunter Lundy/ | 2023-09-25 13:08 | - | |
| Infoworx/ | 2023-10-23 10:46 | - | |
| John Deere/ | 2022-11-02 15:27 | - | |
| John Stefanski/ | 2023-10-09 17:55 | - | |
| Keep LA Beautiful/ | 2023-05-10 10:25 | - | |
| Koch Agronomic/ | 2023-03-30 09:12 | - | |
| LA Ag Hall of Distin..> | 2022-11-02 15:27 | - | |
| LA Beautiful/ | 2023-10-06 13:52 | - | |
| LA Beef/ | 2023-07-25 09:52 | - | |
| LA Casa/ | 2023-06-29 09:07 | - | |
| LA Cert Craft Bev/ | 2022-11-02 15:27 | - | |
| LA Chemical/ | 2023-02-17 11:54 | - | |
| LA Chiropractic Assn/ | 2022-11-15 08:46 | - | |
| LA Crawfish/ | 2023-08-28 11:05 | - | |
| LA Dept of Ag/ | 2023-06-08 08:44 | - | |
| LA Dept of Justice/ | 2022-11-02 15:27 | - | |
| LA Domestic/ | 2022-11-02 15:27 | - | |
| LA Egg/ | 2023-10-19 08:28 | - | |
| LAFA/ | 2022-11-02 15:29 | - | |
| LA Hwy Safety/ | 2023-08-06 15:20 | - | |
| LA Land Bank/ | 2023-10-25 10:33 | - | |
| LA Lottery/ | 2023-11-24 08:21 | - | |
| LA Motor Transport/ | 2022-11-02 15:28 | - | |
| LA One Call/ | 2022-11-02 15:28 | - | |
| LA Restaurant/ | 2022-11-02 15:28 | - | |
| LA Rice Bd/ | 2023-11-20 11:57 | - | |
| LA SOS/ | 2022-11-02 15:28 | - | |
| LA Soy Association/ | 2023-08-16 09:28 | - | |
| LA Soybean/ | 2023-11-24 10:04 | - | |
| LA Strawberry Board/ | 2023-02-15 08:36 | - | |
| LA Tourism/ | 2023-11-14 08:23 | - | |
| LA Treasury/ | 2022-11-02 15:29 | - | |
| LDH Vaccine/ | 2022-11-02 15:29 | - | |
| LSLBC/ | 2022-11-02 15:29 | - | |
| LVS ECO/ | 2022-11-02 15:29 | - | |
| LVS Tourism/ | 2022-11-02 15:29 | - | |
| Land Bank/ | 2022-11-02 15:29 | - | |
| Letlow/ | 2022-11-02 15:29 | - | |
| Licensed Professional/ | 2022-11-02 15:29 | - | |
| Licensing Bd/ | 2022-11-02 15:29 | - | |
| Luba/ | 2023-08-10 09:47 | - | |
| Marty Maley/ | 2023-09-22 08:48 | - | |
| Moon Griffon/ | 2022-11-02 15:29 | - | |
| Mueller/ | 2022-11-02 15:30 | - | |
| New folder/ | 2021-08-26 10:32 | - | |
| Nuseed Carinata/ | 2023-09-08 07:56 | - | |
| Nutrien/ | 2022-11-02 15:30 | - | |
| OAN HiBid/ | 2022-11-02 15:30 | - | |
| PERC/ | 2023-03-01 09:36 | - | |
| Pivot Bio/ | 2023-08-28 10:02 | - | |
| Public Health/ | 2022-11-15 08:43 | - | |
| QTIS/ | 2022-11-02 15:30 | - | |
| RG 2/ | 2022-11-02 15:30 | - | |
| Ralphs Market/ | 2023-04-11 08:52 | - | |
| Reeds/ | 2022-11-02 15:30 | - | |
| SWLA Alliance/ | 2022-11-02 15:30 | - | |
| SW LA Health/ | 2023-05-04 09:00 | - | |
| Sandhill Publishing/ | 2022-11-02 15:30 | - | |
| Scott McKnight/ | 2023-09-14 08:24 | - | |
| Sec of State/ | 2023-09-22 08:17 | - | |
| Senior Medicare/ | 2023-05-01 08:06 | - | |
| Simplot/ | 2023-03-28 10:08 | - | |
| Soybean Bd/ | 2023-11-01 11:16 | - | |
| Stihl/ | 2023-07-12 08:25 | - | |
| Stoneville/ | 2023-08-24 11:10 | - | |
| Sunshine/ | 2023-05-03 14:56 | - | |
| Sygenta NK/ | 2022-11-02 15:30 | - | |
| Tiger Rag/ | 2023-04-06 10:21 | - | |
| Tiger Rag Radio Show/ | 2022-11-02 15:31 | - | |
| Tim Temple/ | 2023-09-19 09:59 | - | |
| Valent Rice/ | 2022-11-02 15:32 | - | |
| Valent Valor/ | 2022-11-02 15:32 | - | |
| Vantage Health/ | 2022-11-02 15:32 | - | |
| Vestaron/ | 2023-08-24 08:18 | - | |
| Veterans/ | 2022-11-11 11:06 | - | |
| ViaSat/ | 2022-11-02 15:32 | - | |
| Volunteer of America/ | 2023-10-30 09:28 | - | |
| Wellcare/ | 2022-11-29 08:16 | - | |
| Whill Ceasars Sports/ | 2022-11-02 15:32 | - | |
| Women In Govt/ | 2023-08-15 14:21 | - | |
| desktop.ini | 2020-08-24 18:22 | 136 | |