![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 60 Plus/ | 2015-12-28 17:56 | - | |
| AARP/ | 2015-12-28 17:55 | - | |
| AFP Louisiana/ | 2015-12-28 17:56 | - | |
| AT&T/ | 2018-01-18 08:40 | - | |
| A and E/ | 2015-12-28 17:59 | - | |
| Actagro/ | 2017-02-22 10:26 | - | |
| Ad Council/ | 2017-04-19 09:55 | - | |
| Ag and Forestry/ | 2015-12-28 18:02 | - | |
| Agrimar/ | 2015-12-28 18:04 | - | |
| Agrium/ | 2018-01-30 15:09 | - | |
| Agronomy/ | 2017-10-26 09:14 | - | |
| Alzheimer's/ | 2015-12-28 17:53 | - | |
| Am Honda/ | 2015-12-28 18:06 | - | |
| Americans for Tax Re..> | 2017-04-12 09:13 | - | |
| Appleton/ | 2015-12-28 17:59 | - | |
| Asgrow/ | 2017-06-08 14:17 | - | |
| Atmos Energy/ | 2017-10-05 08:43 | - | |
| Avipel/ | 2015-12-28 18:08 | - | |
| BASF/ | 2018-01-09 10:17 | - | |
| BF Anderson/ | 2015-12-28 17:55 | - | |
| BP/ | 2015-12-28 17:57 | - | |
| BRAC/ | 2017-12-19 11:28 | - | |
| BR Council on Aging/ | 2015-12-28 18:02 | - | |
| Bayer Belt/ | 2015-12-28 18:01 | - | |
| Bayer Stoneville/ | 2018-03-26 14:21 | - | |
| Bd of Regents/ | 2015-12-28 18:04 | - | |
| Besiege/ | 2017-06-22 13:07 | - | |
| Blue Bell/ | 2018-05-15 11:19 | - | |
| Blue Cross/ | 2015-12-28 18:01 | - | |
| Bonine Bactine/ | 2016-04-26 07:49 | - | |
| Bozeman/ | 2015-12-28 18:04 | - | |
| Brian Low/ | 2017-10-18 09:52 | - | |
| Broadaxe/ | 2016-04-01 12:47 | - | |
| CASA/ | 2015-12-28 18:00 | - | |
| CMS/ | 2015-12-28 17:57 | - | |
| Camellia Rice/ | 2015-12-28 17:53 | - | |
| Case IH/ | 2015-12-28 18:02 | - | |
| Central Life/ | 2018-05-03 10:25 | - | |
| Charlotte McGehee/ | 2015-12-28 17:58 | - | |
| Charter Schools/ | 2016-02-23 08:52 | - | |
| Cheminova/ | 2015-12-28 18:45 | - | |
| Chemtura/ | 2015-12-28 18:03 | - | |
| Children/ | 2015-12-28 18:00 | - | |
| Chrysler/ | 2017-10-06 15:53 | - | |
| Cleco/ | 2017-05-12 10:50 | - | |
| Commerce/ | 2016-03-11 11:55 | - | |
| Community Devleopment/ | 2017-12-15 10:56 | - | |
| Cotton Board/ | 2015-12-28 18:01 | - | |
| Cox Sports/ | 2017-08-15 10:43 | - | |
| Craig Greene/ | 2017-09-27 14:48 | - | |
| Craig Green for PSC/ | 2017-09-27 14:32 | - | |
| Credenza/ | 2017-11-22 09:27 | - | |
| DEQ/ | 2015-12-28 17:53 | - | |
| DHH/ | 2016-03-29 07:59 | - | |
| DOTD/ | 2016-12-27 07:25 | - | |
| Dairy Board/ | 2015-12-28 17:59 | - | |
| David Vitter/ | 2015-12-28 18:02 | - | |
| Dekalb/ | 2015-12-28 17:55 | - | |
| Deltapine/ | 2017-10-31 11:03 | - | |
| Dept of Ag/ | 2017-08-10 15:30 | - | |
| Dept of Insurance/ | 2017-06-01 08:47 | - | |
| Dept of Revenue/ | 2015-12-28 17:58 | - | |
| Dicamba/ | 2017-02-02 08:53 | - | |
| Dinovite/ | 2015-12-28 18:00 | - | |
| Diversified/ | 2017-08-14 09:05 | - | |
| Diversified BASF/ | 2017-01-05 10:43 | - | |
| Dodge Ram/ | 2015-12-28 17:59 | - | |
| Driving LA Forward/ | 2015-12-28 18:00 | - | |
| EQ Health/ | 2015-12-28 18:00 | - | |
| Elderly Affairs/ | 2015-12-28 17:54 | - | |
| Entergy/ | 2015-12-28 17:53 | - | |
| FDS/ | 2016-04-26 07:47 | - | |
| FMC/ | 2018-01-30 15:13 | - | |
| Family Forum/ | 2015-12-28 17:58 | - | |
| Farm Bureau/ | 2018-02-13 09:14 | - | |
| Federation of Teachers/ | 2015-12-28 17:57 | - | |
| Fed of Teachers/ | 2015-12-28 17:54 | - | |
| First Financial/ | 2015-12-28 18:00 | - | |
| First South/ | 2018-05-23 09:31 | - | |
| GAIN/ | 2018-03-14 14:36 | - | |
| GOHSEP/ | 2017-02-16 09:15 | - | |
| Gambling/ | 2015-12-28 17:55 | - | |
| Go Auto/ | 2015-12-28 17:55 | - | |
| Gov Off Eld Afairs/ | 2017-11-09 11:15 | - | |
| Grossenberg/ | 2016-09-01 08:56 | - | |
| H O D/ | 2016-03-23 13:05 | - | |
| HOD/ | 2016-04-07 09:45 | - | |
| Hall of Distinction ..> | 2015-12-28 17:59 | - | |
| Harris Deville/ | 2015-12-28 18:00 | - | |
| Healthy LA/ | 2016-05-27 10:42 | - | |
| Home Builders/ | 2015-12-28 17:58 | - | |
| Hospital Association/ | 2017-01-26 10:58 | - | |
| Hot Fuels/ | 2015-12-28 18:01 | - | |
| Hurricane Tip/ | 2015-12-28 18:02 | - | |
| Hustler Mower/ | 2015-12-28 17:59 | - | |
| Innovative Analytics/ | 2016-09-01 09:09 | - | |
| Investors/ | 2015-12-28 18:01 | - | |
| JD Bank/ | 2016-09-01 08:59 | - | |
| Jay Morris/ | 2015-12-28 18:02 | - | |
| Jazz Fest/ | 2015-12-28 18:03 | - | |
| Jim Donelon/ | 2015-12-28 18:01 | - | |
| John Bel Edwards/ | 2015-12-28 18:01 | - | |
| John Deere/ | 2015-12-28 18:03 | - | |
| John Young/ | 2015-12-28 18:00 | - | |
| Jones Creek Cafe/ | 2017-08-10 09:35 | - | |
| Judicial Crisis Netw..> | 2017-11-07 09:48 | - | |
| Keaux the Sign/ | 2017-03-22 13:46 | - | |
| Kubota/ | 2017-03-22 13:48 | - | |
| LA Answers/ | 2017-04-25 08:46 | - | |
| LA Beef/ | 2018-05-10 08:57 | - | |
| LA CPA/ | 2015-12-28 17:59 | - | |
| LA Cat/ | 2016-03-09 14:44 | - | |
| LA Chemical Assn/ | 2015-12-28 18:01 | - | |
| LA Commerce/ | 2017-09-13 09:46 | - | |
| LA Ctr for Women in ..> | 2016-05-20 10:35 | - | |
| LA Dept of Insurance/ | 2018-04-17 10:24 | - | |
| LA Egg/ | 2018-03-13 09:19 | - | |
| LA Fed of Teachers/ | 2017-07-27 08:50 | - | |
| LA Health Care/ | 2015-12-28 17:53 | - | |
| LA Hospital Assn/ | 2018-05-11 14:50 | - | |
| LA Housing Corp/ | 2015-12-28 18:00 | - | |
| LA Land Bank/ | 2017-07-25 09:34 | - | |
| LA Licensing Board/ | 2018-01-09 08:56 | - | |
| LA Lottery/ | 2018-04-16 13:37 | - | |
| LAMP/ | 2016-06-20 08:06 | - | |
| LA Municipal/ | 2015-12-28 18:02 | - | |
| LA Nursery/ | 2017-04-06 09:23 | - | |
| LA Nursing Home/ | 2017-04-20 14:28 | - | |
| LA Office of Tourism/ | 2018-04-26 10:43 | - | |
| LA Ophthalmology/ | 2015-12-28 17:55 | - | |
| LA Optometry/ | 2015-12-28 17:58 | - | |
| LA Propane Gas/ | 2017-12-21 08:15 | - | |
| LA Rents/ | 2015-12-28 18:01 | - | |
| LA Restaurant Assn/ | 2017-10-24 14:10 | - | |
| LA Rice Bd/ | 2017-12-20 10:38 | - | |
| LA School Boards Assn/ | 2015-12-28 18:00 | - | |
| LA Soybean Board/ | 2018-01-11 08:50 | - | |
| LA State Library/ | 2015-12-28 17:55 | - | |
| LA State Licensing Bd/ | 2017-06-27 11:26 | - | |
| LA Strawberry Bd/ | 2018-02-20 08:20 | - | |
| LA Tax Payer/ | 2017-10-03 14:13 | - | |
| LA Veterans/ | 2015-12-28 18:02 | - | |
| LA Wildlife and Fish..> | 2015-12-28 17:53 | - | |
| LCI/ | 2015-12-28 17:54 | - | |
| LCTCS/ | 2015-12-28 17:54 | - | |
| LFBARN/ | 2015-12-28 18:03 | - | |
| LIfe Sciences/ | 2018-04-26 13:23 | - | |
| LPB/ | 2015-12-28 18:02 | - | |
| LP Gas/ | 2015-12-28 17:59 | - | |
| LRN/ | 2016-02-11 17:21 | - | |
| LRN Web/ | 2015-12-28 17:53 | - | |
| LUBA/ | 2017-02-22 10:24 | - | |
| LWCC/ | 2015-12-28 18:02 | - | |
| Land Bank/ | 2016-06-10 08:25 | - | |
| Leanweb/ | 2015-12-28 17:55 | - | |
| Legal Integrity/ | 2015-12-28 18:02 | - | |
| Lumber Liquidators/ | 2015-12-28 17:57 | - | |
| Luxor/ | 2015-12-28 17:59 | - | |
| MOD 39WKS/ | 2015-12-28 17:53 | - | |
| Macys/ | 2015-12-28 17:59 | - | |
| Manda Meats/ | 2017-02-08 09:56 | - | |
| March of Dimes/ | 2015-12-28 18:01 | - | |
| Matt Parker/ | 2015-12-28 17:59 | - | |
| Miscellaneous/ | 2015-12-28 17:55 | - | |
| Monsanto/ | 2018-05-21 09:42 | - | |
| Moon Griffon/ | 2015-12-28 17:59 | - | |
| Mudbugs/ | 2015-12-28 17:53 | - | |
| Mueller/ | 2017-01-26 11:08 | - | |
| NAFB/ | 2015-12-28 18:03 | - | |
| NBC/ | 2015-12-28 18:07 | - | |
| NRA-ILA/ | 2016-12-02 15:36 | - | |
| NRA/ | 2016-12-02 15:39 | - | |
| NTCA/ | 2015-12-28 18:02 | - | |
| NTS/ | 2015-12-28 17:54 | - | |
| Nat Right to Life/ | 2017-11-20 10:50 | - | |
| Nat Taxpayer Un/ | 2015-12-28 17:56 | - | |
| National Right To Life/ | 2017-11-20 13:45 | - | |
| New folder/ | 2018-04-26 13:23 | - | |
| Nicaud/ | 2015-12-28 18:00 | - | |
| Northwestern Univ/ | 2015-12-28 17:54 | - | |
| Nungesser/ | 2015-12-28 17:55 | - | |
| Office of State Parks/ | 2015-12-28 17:53 | - | |
| One Nation Under God/ | 2016-12-02 14:05 | - | |
| Operation Lifesaver/ | 2016-07-08 11:43 | - | |
| Operation Lifesaver ..> | 2015-12-28 17:53 | - | |
| Our Coast/ | 2016-11-04 10:47 | - | |
| PI/ | 2015-12-28 17:57 | - | |
| Pat. Majority/ | 2015-12-28 18:00 | - | |
| Patriotic Veterans/ | 2015-12-28 18:01 | - | |
| Pennington Seed/ | 2017-08-03 06:59 | - | |
| Pfizer/ | 2015-12-28 17:58 | - | |
| Pioneer/ | 2018-02-01 09:05 | - | |
| Pioneer Corn/ | 2017-08-16 15:00 | - | |
| Pioneer Soybean/ | 2018-03-22 09:14 | - | |
| Police Jury/ | 2015-12-28 18:03 | - | |
| Powerball/ | 2015-12-28 18:00 | - | |
| Priaxor/ | 2015-12-28 18:03 | - | |
| Progeny/ | 2017-09-05 08:02 | - | |
| Progressive/ | 2017-02-22 10:28 | - | |
| QTIS/ | 2017-03-07 13:58 | - | |
| Quality/ | 2016-03-11 10:17 | - | |
| Rebuild LA/ | 2017-07-18 10:40 | - | |
| Red Roof Inn/ | 2015-12-28 18:07 | - | |
| Rent A Center/ | 2016-03-03 06:59 | - | |
| Restore Louisiana/ | 2017-12-01 11:25 | - | |
| Restore Our Coast/ | 2016-11-01 15:13 | - | |
| Rice Bd/ | 2017-09-07 14:04 | - | |
| Rice Tec/ | 2015-12-28 18:00 | - | |
| Right to Life/ | 2015-12-28 18:00 | - | |
| Rio Barker/ | 2016-12-29 08:53 | - | |
| Rio Wine Cellar/ | 2017-12-21 08:17 | - | |
| Rural Water/ | 2015-12-28 17:59 | - | |
| Sandler Training/ | 2017-02-08 09:53 | - | |
| Schedler/ | 2015-12-28 17:54 | - | |
| Scott Equipment/ | 2015-12-28 18:00 | - | |
| Sec of State/ | 2017-09-26 11:00 | - | |
| Senator Warren Harrang/ | 2017-05-17 11:15 | - | |
| Sercadis/ | 2015-12-28 18:01 | - | |
| Serta/ | 2017-11-02 09:49 | - | |
| Silver 7/ | 2015-12-28 17:54 | - | |
| Simmons/ | 2017-11-02 09:51 | - | |
| Sizzlin 7s/ | 2015-12-28 17:57 | - | |
| Southside/ | 2017-12-28 10:03 | - | |
| Soybean Board/ | 2017-11-30 10:36 | - | |
| Stand for Children/ | 2016-04-08 08:39 | - | |
| State Parks/ | 2016-02-09 09:59 | - | |
| Stihl/ | 2018-04-12 10:43 | - | |
| Stoke Belt/ | 2015-12-28 18:07 | - | |
| Stoneville/ | 2018-03-29 09:43 | - | |
| Strain/ | 2015-12-28 17:53 | - | |
| Strawberry Bd/ | 2017-02-27 09:45 | - | |
| Student Financial As..> | 2017-06-01 10:23 | - | |
| Summer Days/ | 2015-12-28 18:02 | - | |
| Super Beta/ | 2015-12-28 17:58 | - | |
| Superior Livestock/ | 2018-03-29 08:40 | - | |
| Sygenta/ | 2017-06-01 08:50 | - | |
| Tax Relief/ | 2015-12-28 18:00 | - | |
| Teachers/ | 2015-12-28 18:01 | - | |
| Teammates/ | 2015-12-28 17:53 | - | |
| Terral Seed/ | 2015-12-28 18:02 | - | |
| Thai Kitchen/ | 2016-03-24 11:29 | - | |
| Thumbs.db | 2015-12-28 18:00 | 31K | |
| Tiger Rag/ | 2017-11-30 13:47 | - | |
| Tiger Rag Radio Show/ | 2015-12-28 18:06 | - | |
| Tobacco Free/ | 2017-01-05 10:24 | - | |
| Tomorrow Sleep/ | 2018-03-27 09:18 | - | |
| Toro Tagged Spots/ | 2015-12-28 18:21 | - | |
| Tourism/ | 2018-02-08 09:19 | - | |
| Toys R Us/ | 2015-12-28 18:06 | - | |
| Tractor Supply/ | 2017-09-05 08:07 | - | |
| Troy Bilt/ | 2015-12-28 17:53 | - | |
| US Army/ | 2017-08-10 08:52 | - | |
| US Dot/ | 2016-07-29 07:50 | - | |
| UVA/ | 2017-05-02 14:01 | - | |
| University View/ | 2018-03-06 13:22 | - | |
| Vantage Health/ | 2016-10-11 10:08 | - | |
| Vitter/ | 2015-12-28 18:00 | - | |
| Volunteers of America/ | 2016-12-01 16:25 | - | |
| Warren Harrang/ | 2017-05-17 14:12 | - | |
| Wellmedix/ | 2016-04-26 11:00 | - | |
| Wk of Nov 7/ | 2016-11-04 10:55 | - | |
| Wk of Oct 24/ | 2016-10-21 13:43 | - | |
| Xemium/ | 2015-12-28 17:58 | - | |
| Xtend/ | 2016-09-01 13:37 | - | |
| Young/ | 2015-12-28 18:00 | - | |