![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 60 Plus/ | 2018-05-31 09:19 | - | |
| AARP/ | 2018-05-31 09:19 | - | |
| AFP Louisiana/ | 2018-05-31 09:19 | - | |
| AM Sugarcane/ | 2019-09-26 09:13 | - | |
| AT&T/ | 2019-09-26 09:06 | - | |
| A and E/ | 2018-05-31 09:19 | - | |
| Abraham For Governor/ | 2019-10-08 08:49 | - | |
| Acadian Ambulance/ | 2019-08-08 08:52 | - | |
| Actagro/ | 2018-05-31 09:19 | - | |
| Ad Council/ | 2018-05-31 09:19 | - | |
| Adama/ | 2020-01-30 08:27 | - | |
| Affordable Drugs/ | 2020-03-11 14:46 | - | |
| Ag and Forestry/ | 2018-05-31 09:19 | - | |
| Agrimar/ | 2018-05-31 09:19 | - | |
| Agrium/ | 2018-05-31 09:19 | - | |
| Agronomy/ | 2018-05-31 09:19 | - | |
| Alzheimer's/ | 2018-05-31 09:19 | - | |
| Am For Tax Reform/ | 2019-08-13 14:02 | - | |
| Am Honda/ | 2018-05-31 09:19 | - | |
| American For Prosper..> | 2019-08-01 10:21 | - | |
| Americans for Tax Re..> | 2018-05-31 09:19 | - | |
| Appleton/ | 2018-05-31 09:19 | - | |
| Ardoin/ | 2019-10-25 08:39 | - | |
| Asgrow/ | 2018-05-31 09:20 | - | |
| Atmos Energy/ | 2020-05-12 09:55 | - | |
| Avipel/ | 2018-05-31 09:20 | - | |
| BASF/ | 2020-06-06 12:41 | - | |
| BASF BSC/ | 2019-04-11 10:29 | - | |
| BF Anderson/ | 2018-05-31 09:20 | - | |
| BP/ | 2018-05-31 09:20 | - | |
| BRAC/ | 2019-08-28 13:22 | - | |
| BR Council on Aging/ | 2018-05-31 09:20 | - | |
| Bayer/ | 2019-10-31 08:55 | - | |
| Bayer Belt/ | 2018-05-31 09:20 | - | |
| Bayer Farm For Good/ | 2019-02-25 08:47 | - | |
| Bayer HOD/ | 2020-05-07 10:44 | - | |
| Bayer Stoneville/ | 2018-05-31 09:20 | - | |
| Bd of Regents/ | 2018-05-31 09:20 | - | |
| Besiege/ | 2018-05-31 09:20 | - | |
| Blue Bell/ | 2019-07-18 08:54 | - | |
| Blue Cross/ | 2019-10-10 09:36 | - | |
| Bonine Bactine/ | 2018-05-31 09:20 | - | |
| Bozeman/ | 2018-08-09 09:03 | - | |
| Brian Low/ | 2018-05-31 09:20 | - | |
| Broadaxe/ | 2018-05-31 09:20 | - | |
| CASA/ | 2018-05-31 09:20 | - | |
| CMS/ | 2018-05-31 09:21 | - | |
| Camellia Rice/ | 2018-05-31 09:20 | - | |
| Case IH/ | 2018-05-31 09:20 | - | |
| Central Life/ | 2018-05-31 09:20 | - | |
| Charlotte McGehee/ | 2018-05-31 09:20 | - | |
| Charter Schools/ | 2018-05-31 09:20 | - | |
| Cheminova/ | 2018-05-31 09:20 | - | |
| Chemtura/ | 2018-05-31 09:20 | - | |
| Children/ | 2018-05-31 09:20 | - | |
| Chrysler/ | 2018-05-31 09:21 | - | |
| Circle T Farm/ | 2019-07-25 08:20 | - | |
| Cleco/ | 2018-05-31 09:21 | - | |
| Comm Strain/ | 2020-04-09 09:13 | - | |
| Commerce/ | 2018-05-31 09:21 | - | |
| Community Devleopment/ | 2018-05-31 09:21 | - | |
| Constitutional Integ..> | 2018-10-31 08:50 | - | |
| Core Feed/ | 2019-08-09 09:49 | - | |
| Cotton Board/ | 2018-05-31 09:21 | - | |
| Cox Sports/ | 2020-01-23 08:30 | - | |
| Craig Greene/ | 2018-05-31 09:21 | - | |
| Craig Green for PSC/ | 2018-05-31 09:21 | - | |
| Crawler/ | 2018-10-23 11:32 | - | |
| Credenza/ | 2018-05-31 09:21 | - | |
| Crop Protection/ | 2018-12-07 09:24 | - | |
| Cummins/ | 2019-05-14 11:52 | - | |
| DEQ/ | 2018-05-31 09:22 | - | |
| DHH/ | 2018-05-31 09:22 | - | |
| DOTD/ | 2018-05-31 09:22 | - | |
| Dairy Board/ | 2018-05-31 09:21 | - | |
| David Vitter/ | 2018-05-31 09:21 | - | |
| Dekalb/ | 2018-05-31 09:21 | - | |
| Deltapine/ | 2019-10-28 09:12 | - | |
| Dept of Ag/ | 2020-04-30 08:42 | - | |
| Dept of Insurance/ | 2020-05-22 10:29 | - | |
| Dept of Justice/ | 2020-06-19 13:26 | - | |
| Dept of Revenue/ | 2018-05-31 09:22 | - | |
| Dicamba/ | 2018-05-31 09:22 | - | |
| Dinovite/ | 2018-05-31 09:22 | - | |
| Diversified/ | 2019-02-07 08:48 | - | |
| Diversified BASF/ | 2018-05-31 09:22 | - | |
| Dodge Ram/ | 2015-12-28 17:59 | - | |
| Donelon/ | 2019-09-18 14:28 | - | |
| Driving LA Forward/ | 2018-05-31 09:22 | - | |
| EQ Health/ | 2018-05-31 09:22 | - | |
| Edwards for Governor/ | 2019-10-04 13:52 | - | |
| Elderly Affairs/ | 2018-05-31 09:22 | - | |
| Entergy/ | 2019-09-17 11:12 | - | |
| FDS/ | 2018-05-31 09:22 | - | |
| FMC/ | 2020-01-23 08:33 | - | |
| Family Forum/ | 2018-05-31 09:22 | - | |
| Farm Bureau/ | 2018-05-31 09:22 | - | |
| Federation of Teachers/ | 2019-05-23 12:31 | - | |
| Fed of Teachers/ | 2018-05-31 09:22 | - | |
| Feliciana Farmers CoOp/ | 2019-08-16 08:53 | - | |
| Festival/ | 2019-05-09 13:43 | - | |
| First Financial/ | 2018-05-31 09:22 | - | |
| First South/ | 2020-07-09 11:36 | - | |
| GAIN/ | 2018-05-31 09:22 | - | |
| GOHSEP/ | 2020-07-08 10:05 | - | |
| Gambling/ | 2018-05-31 09:22 | - | |
| Go Auto/ | 2018-05-31 09:22 | - | |
| Gov Off Eld Afairs/ | 2018-05-31 09:22 | - | |
| Grossenberg/ | 2018-05-31 09:22 | - | |
| Grow LA Coalition/ | 2019-04-11 08:42 | - | |
| H O D/ | 2018-10-30 14:45 | - | |
| HOD/ | 2019-10-16 15:18 | - | |
| Hall of Distinction ..> | 2018-05-31 09:22 | - | |
| Hall of Distinction/ | 2020-03-17 09:03 | - | |
| Harris Deville/ | 2018-05-31 09:22 | - | |
| Healthy LA/ | 2018-05-31 09:22 | - | |
| Home Builders/ | 2018-05-31 09:22 | - | |
| Honda/ | 2018-08-02 07:20 | - | |
| Hospital Association/ | 2018-05-31 09:22 | - | |
| Hot Fuels/ | 2018-05-31 09:22 | - | |
| Hurricane Tip/ | 2018-05-31 09:22 | - | |
| Hustler Mower/ | 2018-05-31 09:22 | - | |
| IndigoAgMarketPlace/ | 2019-12-05 09:58 | - | |
| Innovative Analytics/ | 2018-05-31 09:22 | - | |
| Investors/ | 2018-05-31 09:22 | - | |
| JD Bank/ | 2018-05-31 09:22 | - | |
| Jay Morris/ | 2018-05-31 09:22 | - | |
| Jazz Fest/ | 2018-05-31 09:22 | - | |
| Jim Donelon/ | 2018-05-31 09:22 | - | |
| John Bel Edwards/ | 2019-08-20 08:17 | - | |
| John Deere/ | 2018-05-31 09:22 | - | |
| John Young/ | 2018-05-31 09:22 | - | |
| Jones Creek Cafe/ | 2018-05-31 09:22 | - | |
| Judicial Crisis Netw..> | 2018-05-31 09:22 | - | |
| Keaux the Sign/ | 2018-05-31 09:22 | - | |
| Kentwood Coop/ | 2019-07-25 08:17 | - | |
| Kubota/ | 2018-05-31 09:22 | - | |
| Kyle Ardoin for Sec ..> | 2018-12-07 09:23 | - | |
| LA Answers/ | 2018-05-31 09:22 | - | |
| LA Asgrow/ | 2020-07-10 08:29 | - | |
| LA Beef/ | 2020-06-18 09:01 | - | |
| LA CASA/ | 2019-11-19 13:40 | - | |
| LA CPA/ | 2018-05-31 09:22 | - | |
| LA Cat/ | 2018-05-31 09:22 | - | |
| LA Chemical Assn/ | 2018-05-31 09:22 | - | |
| LA Chiropractor Asso..> | 2019-11-18 10:05 | - | |
| LA Citizens/ | 2019-11-01 10:31 | - | |
| LA Commerce/ | 2018-05-31 09:22 | - | |
| LA Crawfish Board/ | 2020-04-20 09:53 | - | |
| LA Ctr for Women in ..> | 2018-05-31 09:22 | - | |
| LA Dept of Ag/ | 2020-04-30 08:41 | - | |
| LA Dept of Health/ | 2020-01-30 09:09 | - | |
| LA Dept of Insurance/ | 2019-08-13 08:49 | - | |
| LA Dept of Treasury/ | 2020-04-06 09:01 | - | |
| LA Egg/ | 2019-11-19 13:43 | - | |
| LA Fed of Teachers/ | 2018-05-31 09:22 | - | |
| LA Health Care/ | 2018-05-31 09:22 | - | |
| LA Hospital Assn/ | 2018-05-31 09:22 | - | |
| LA Housing Corp/ | 2018-06-08 13:04 | - | |
| LA Land Bank/ | 2019-08-21 08:39 | - | |
| LA Licensing Board/ | 2018-12-07 09:32 | - | |
| LA Lottery/ | 2020-07-10 13:38 | - | |
| LAMP/ | 2018-05-31 09:23 | - | |
| LA Municipal/ | 2018-05-31 09:23 | - | |
| LA Nursery/ | 2018-05-31 09:23 | - | |
| LA Nursing Home/ | 2018-05-31 09:23 | - | |
| LA Office of Tourism/ | 2019-05-03 08:30 | - | |
| LA Ophthalmology/ | 2018-05-31 09:23 | - | |
| LA Optometry/ | 2018-05-31 09:23 | - | |
| LA Propane Gas/ | 2019-12-19 08:57 | - | |
| LA Rents/ | 2018-05-31 09:23 | - | |
| LA Restaurant Assn/ | 2020-04-09 09:11 | - | |
| LA Rice Bd/ | 2020-01-02 08:52 | - | |
| LA School Boards Assn/ | 2018-05-31 09:23 | - | |
| LA Sec of State/ | 2019-09-26 09:03 | - | |
| LA Soybean Board/ | 2020-05-28 08:50 | - | |
| LA State Library/ | 2018-05-31 09:23 | - | |
| LA State Licensing Bd/ | 2018-05-31 09:23 | - | |
| LA Strawberry Bd/ | 2020-02-20 08:39 | - | |
| LA Tax Payer/ | 2018-05-31 09:23 | - | |
| LA Veterans/ | 2018-05-31 09:23 | - | |
| LA Wildlife and Fish..> | 2018-05-31 09:23 | - | |
| LA for Energy/ | 2018-07-12 14:54 | - | |
| LCI/ | 2018-05-31 09:23 | - | |
| LCTCS/ | 2018-05-31 09:23 | - | |
| LFBARN/ | 2018-05-31 09:23 | - | |
| LIfe Sciences/ | 2018-05-31 09:23 | - | |
| LPB/ | 2018-05-31 09:23 | - | |
| LP Gas/ | 2018-05-31 09:23 | - | |
| LRN/ | 2019-01-14 08:49 | - | |
| LRN Promos/ | 2019-01-09 09:38 | - | |
| LRN Web/ | 2018-05-31 09:23 | - | |
| LS Tractor/ | 2019-07-24 13:55 | - | |
| LUBA/ | 2019-08-16 09:46 | - | |
| LWCC/ | 2018-05-31 09:23 | - | |
| Land Bank/ | 2018-05-31 09:23 | - | |
| Landry Atty Gen/ | 2019-10-01 10:41 | - | |
| Leanweb/ | 2018-05-31 09:23 | - | |
| Legal Integrity/ | 2018-05-31 09:23 | - | |
| Lumber Liquidators/ | 2018-05-31 09:23 | - | |
| Luxor/ | 2018-05-31 09:23 | - | |
| MOD 39WKS/ | 2018-05-31 09:23 | - | |
| Macys/ | 2018-05-31 09:23 | - | |
| Manda Meats/ | 2018-05-31 09:23 | - | |
| March of Dimes/ | 2018-05-31 09:23 | - | |
| Matt Parker/ | 2018-05-31 09:23 | - | |
| Miscellaneous/ | 2018-05-31 09:23 | - | |
| Mon Bayer/ | 2019-05-07 09:29 | - | |
| Mon Deltapine/ | 2019-05-02 09:23 | - | |
| Monsanto/ | 2018-08-23 08:58 | - | |
| Moon Griffon/ | 2018-05-31 09:24 | - | |
| Mudbugs/ | 2018-05-31 09:24 | - | |
| Mueller/ | 2020-03-31 09:11 | - | |
| NAFB/ | 2018-05-31 09:24 | - | |
| NBC/ | 2018-05-31 09:24 | - | |
| NRA-ILA/ | 2018-05-31 09:24 | - | |
| NRA/ | 2018-05-31 09:24 | - | |
| NTCA/ | 2018-05-31 09:24 | - | |
| NTS/ | 2018-05-31 09:24 | - | |
| Nat Right to Life/ | 2018-05-31 09:24 | - | |
| Nat Taxpayer Un/ | 2018-05-31 09:24 | - | |
| National Right To Life/ | 2018-05-31 09:24 | - | |
| New Text Document.txt | 2019-02-25 08:46 | 0 | |
| Nicaud/ | 2018-05-31 09:24 | - | |
| Northwestern Univ/ | 2018-05-31 09:24 | - | |
| Nungesser/ | 2018-05-31 09:24 | - | |
| Nutrien Crop Protect..> | 2019-09-13 09:50 | - | |
| Office of State Parks/ | 2018-05-31 09:24 | - | |
| Office of the Governor/ | 2020-03-19 08:49 | - | |
| One Nation Under God/ | 2018-05-31 09:24 | - | |
| Operation Lifesaver/ | 2018-05-31 09:24 | - | |
| Operation Lifesaver ..> | 2018-05-31 09:24 | - | |
| Orleans Hotel/ | 2020-01-28 14:15 | - | |
| Our Coast/ | 2018-05-31 09:24 | - | |
| PI/ | 2018-05-31 09:24 | - | |
| Pat. Majority/ | 2018-05-31 09:24 | - | |
| Patriotic Veterans/ | 2018-05-31 09:24 | - | |
| Pennington Seed/ | 2018-05-31 09:24 | - | |
| Pfizer/ | 2018-05-31 09:24 | - | |
| Pioneer/ | 2018-11-20 09:34 | - | |
| Pioneer Corn/ | 2019-09-24 09:46 | - | |
| Pioneer Soybean/ | 2019-09-27 11:12 | - | |
| Pioneer Tru Choice/ | 2019-10-25 08:46 | - | |
| Police Jury/ | 2018-05-31 09:25 | - | |
| Powerball/ | 2018-05-31 09:25 | - | |
| Prarieville Family H..> | 2019-07-25 16:11 | - | |
| Priaxor/ | 2018-05-31 09:25 | - | |
| Progeny/ | 2018-09-28 11:52 | - | |
| Progressive/ | 2018-05-31 09:25 | - | |
| Protect My Car/ | 2020-01-30 08:25 | - | |
| QTIS/ | 2018-05-31 09:25 | - | |
| QT Market Center/ | 2019-06-19 10:00 | - | |
| Quality/ | 2018-05-31 09:25 | - | |
| Raceland Ag/ | 2019-07-25 08:27 | - | |
| Ralph Market/ | 2019-09-06 14:54 | - | |
| Ralphs Market/ | 2020-06-10 09:41 | - | |
| Rebuild LA/ | 2018-05-31 09:25 | - | |
| Red Roof Inn/ | 2018-05-31 09:25 | - | |
| Rent A Center/ | 2018-05-31 09:25 | - | |
| Restore Louisiana/ | 2018-05-31 09:25 | - | |
| Restore Our Coast/ | 2018-05-31 09:25 | - | |
| Rice Bd/ | 2018-05-31 09:25 | - | |
| Rice Tec/ | 2018-05-31 09:25 | - | |
| Right to Life/ | 2018-05-31 09:25 | - | |
| Rio Barker/ | 2018-05-31 09:25 | - | |
| Rio Wine Cellar/ | 2018-05-31 09:25 | - | |
| Rispone Gov/ | 2019-10-09 12:04 | - | |
| Rural Water/ | 2018-05-31 09:25 | - | |
| Sandler Training/ | 2018-05-31 09:25 | - | |
| Schedler/ | 2018-05-31 09:25 | - | |
| Scott Equipment/ | 2018-05-31 09:25 | - | |
| Sec of State/ | 2020-06-05 10:44 | - | |
| Senator Warren Harrang/ | 2018-05-31 09:25 | - | |
| Sercadis/ | 2018-05-31 09:25 | - | |
| Serta/ | 2018-05-31 09:25 | - | |
| Silver 7/ | 2018-05-31 09:25 | - | |
| Simmons/ | 2018-05-31 09:25 | - | |
| Sizzlin 7s/ | 2018-05-31 09:25 | - | |
| Southside/ | 2018-05-31 09:25 | - | |
| Soybean Board/ | 2018-05-31 09:26 | - | |
| Stand for Children/ | 2018-05-31 09:26 | - | |
| State Parks/ | 2018-05-31 09:26 | - | |
| Stihl/ | 2020-05-26 10:28 | - | |
| Stoke Belt/ | 2018-05-31 09:26 | - | |
| Stoneville/ | 2018-12-04 14:32 | - | |
| Strain/ | 2018-05-31 09:26 | - | |
| Strain Re Election 2..> | 2019-08-23 09:41 | - | |
| Strawberry Bd/ | 2018-05-31 09:26 | - | |
| Student Financial As..> | 2018-05-31 09:26 | - | |
| Summer Days/ | 2018-05-31 09:26 | - | |
| Sunshine Quality Equ..> | 2019-10-16 15:16 | - | |
| Super Beta/ | 2018-05-31 09:26 | - | |
| Superior Livestock/ | 2018-05-31 09:26 | - | |
| Sygenta/ | 2020-02-13 10:05 | - | |
| Tax Relief/ | 2018-05-31 09:26 | - | |
| Teachers/ | 2018-05-31 09:26 | - | |
| Teammates/ | 2018-05-31 09:26 | - | |
| Temple/ | 2019-10-04 13:56 | - | |
| Terral Seed/ | 2018-05-31 09:26 | - | |
| Thai Kitchen/ | 2018-05-31 09:26 | - | |
| The Outpost/ | 2019-09-06 13:57 | - | |
| Thumbs.db | 2015-12-28 18:00 | 31K | |
| Tiger Rag/ | 2020-07-01 08:56 | - | |
| Tiger Rag Radio Show/ | 2018-05-31 09:27 | - | |
| Tiger Rag TV/ | 2019-10-08 10:33 | - | |
| Tobacco Free/ | 2020-07-08 09:57 | - | |
| Tomorrow Sleep/ | 2018-05-31 09:42 | - | |
| Toro Tagged Spots/ | 2018-05-31 09:27 | - | |
| Tourism/ | 2018-08-02 07:22 | - | |
| Toys R Us/ | 2018-05-31 09:27 | - | |
| Tractor Supply/ | 2018-08-09 08:44 | - | |
| Treasurer/ | 2019-04-11 08:45 | - | |
| Tri Parish Coop/ | 2019-07-25 08:29 | - | |
| Troy Bilt/ | 2018-05-31 09:27 | - | |
| US Army/ | 2019-08-29 10:42 | - | |
| US Dot/ | 2018-05-31 09:27 | - | |
| UVA/ | 2018-05-31 09:27 | - | |
| University View/ | 2020-03-17 08:22 | - | |
| Valent/ | 2019-12-13 09:34 | - | |
| Vantage Health/ | 2019-08-20 11:53 | - | |
| Vitter/ | 2018-05-31 09:27 | - | |
| Volunteer LA/ | 2020-05-22 10:21 | - | |
| Volunteers of America/ | 2018-05-31 09:27 | - | |
| Warren Harrang/ | 2018-05-31 09:27 | - | |
| Wellmedix/ | 2018-05-31 09:27 | - | |
| Wk of Nov 7/ | 2018-05-31 09:28 | - | |
| Wk of Oct 24/ | 2018-05-31 09:28 | - | |
| Women in Government/ | 2020-02-26 14:03 | - | |
| Xemium/ | 2018-05-31 09:28 | - | |
| Xtend/ | 2018-05-31 09:28 | - | |
| Young/ | 2018-05-31 09:28 | - | |